C17H12N2O2 — CID 137178547
2-(3-methylphenyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one (PubChem CID 137178547) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(3-methylphenyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(3-methylphenyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137178547 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-(3-methylphenyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| SMILES | Cc1cccc(-c2nc3c(oc4ccccc43)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C17H12N2O2/c1-10-5-4-6-11(9-10)16-18-14-12-7-2-3-8-13(12)21-15(14)17(20)19-16/h2-9H,1H3,(H,18,19,20) |
| InChIKey | DDGGFIXDHOHGCQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |