C18H14N2O3 — CID 136629673
8-methyl-2-(phenoxymethyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one (PubChem CID 136629673) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 8-methyl-2-(phenoxymethyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one.
| Compound Name | 8-methyl-2-(phenoxymethyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136629673 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 8-methyl-2-(phenoxymethyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| SMILES | Cc1ccc2oc3c(=O)[nH]c(COc4ccccc4)nc3c2c1 |
| InChI | InChI=1S/C18H14N2O3/c1-11-7-8-14-13(9-11)16-17(23-14)18(21)20-15(19-16)10-22-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,19,20,21) |
| InChIKey | GZPIHNTYWHKZIV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |