C24H20N8O2S — CID 137185738
(2Z)-5-[(4-methoxyphenyl)methylidene]-2-[[3-methyl-1-phenyl-5-(1,2,4-triazol-1-yl)pyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 137185738) has the molecular formula C24H20N8O2S and a molecular weight of 484.55 g/mol. Its IUPAC name is (2Z)-5-[(4-methoxyphenyl)methylidene]-2-[[3-methyl-1-phenyl-5-(1,2,4-triazol-1-yl)pyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-[(4-methoxyphenyl)methylidene]-2-[[3-methyl-1-phenyl-5-(1,2,4-triazol-1-yl)pyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137185738 |
| Molecular Formula | C24H20N8O2S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (2Z)-5-[(4-methoxyphenyl)methylidene]-2-[[3-methyl-1-phenyl-5-(1,2,4-triazol-1-yl)pyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=C2S/C(=N\N=Cc3c(C)nn(-c4ccccc4)c3-n3cncn3)NC2=O)cc1 |
| InChI | InChI=1S/C24H20N8O2S/c1-16-20(23(31-15-25-14-27-31)32(30-16)18-6-4-3-5-7-18)13-26-29-24-28-22(33)21(35-24)12-17-8-10-19(34-2)11-9-17/h3-15H,1-2H3,(H,28,29,33) |
| InChIKey | LPZKTEYZRYPOON-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|