C20H18ClN4O3S+ — CID 137187684
(6R)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3-prop-2-enylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137187684) has the molecular formula C20H18ClN4O3S+ and a molecular weight of 429.91 g/mol. Its IUPAC name is (6R)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3-prop-2-enylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3-prop-2-enylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137187684 |
| Molecular Formula | C20H18ClN4O3S+ |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (6R)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3-prop-2-enylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | C=CCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N[C@H]2c1cc(Cl)c(O)c(OC)c1 |
| InChI | InChI=1S/C20H17ClN4O3S/c1-3-8-29-20-23-19(27)16-12-6-4-5-7-14(12)22-18(25(16)24-20)11-9-13(21)17(26)15(10-11)28-2/h3-7,9-10,18H,1,8H2,2H3,(H2,23,24,26,27)/p+1/t18-/m1/s1 |
| InChIKey | AGAQSPLDMKLWIU-GOSISDBHSA-O |
| XLogP | 3.34 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|