C26H25N4O4S+ — CID 137188204
(6S)-6-(4-hydroxy-3,5-dimethoxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188204) has the molecular formula C26H25N4O4S+ and a molecular weight of 489.58 g/mol. Its IUPAC name is (6S)-6-(4-hydroxy-3,5-dimethoxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-6-(4-hydroxy-3,5-dimethoxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188204 |
| Molecular Formula | C26H25N4O4S+ |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (6S)-6-(4-hydroxy-3,5-dimethoxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | COc1cc([C@H]2Nc3ccccc3-c3c(=O)[nH]c(SCc4ccc(C)cc4)n[n+]32)cc(OC)c1O |
| InChI | InChI=1S/C26H24N4O4S/c1-15-8-10-16(11-9-15)14-35-26-28-25(32)22-18-6-4-5-7-19(18)27-24(30(22)29-26)17-12-20(33-2)23(31)21(13-17)34-3/h4-13,24H,14H2,1-3H3,(H2,28,29,31,32)/p+1/t24-/m0/s1 |
| InChIKey | GCVGUZLVOVPIDY-DEOSSOPVSA-O |
| XLogP | 4.02 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|