C31H35N4O2S+ — CID 137188035
(6S)-3-benzylsulfanyl-6-(3,5-ditert-butyl-4-hydroxyphenyl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188035) has the molecular formula C31H35N4O2S+ and a molecular weight of 527.71 g/mol. Its IUPAC name is (6S)-3-benzylsulfanyl-6-(3,5-ditert-butyl-4-hydroxyphenyl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-3-benzylsulfanyl-6-(3,5-ditert-butyl-4-hydroxyphenyl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188035 |
| Molecular Formula | C31H35N4O2S+ |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | (6S)-3-benzylsulfanyl-6-(3,5-ditert-butyl-4-hydroxyphenyl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CC(C)(C)c1cc([C@H]2Nc3ccccc3-c3c(=O)[nH]c(SCc4ccccc4)n[n+]32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H34N4O2S/c1-30(2,3)22-16-20(17-23(26(22)36)31(4,5)6)27-32-24-15-11-10-14-21(24)25-28(37)33-29(34-35(25)27)38-18-19-12-8-7-9-13-19/h7-17,27H,18H2,1-6H3,(H2,33,34,36,37)/p+1/t27-/m0/s1 |
| InChIKey | LTOUORPRSBQJGA-MHZLTWQESA-O |
| XLogP | 6.29 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|