C32H37N4O2S+ — CID 137189651
(6S)-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137189651) has the molecular formula C32H37N4O2S+ and a molecular weight of 541.74 g/mol. Its IUPAC name is (6S)-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137189651 |
| Molecular Formula | C32H37N4O2S+ |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (6S)-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | Cc1ccc(CSc2n[n+]3c(c(=O)[nH]2)-c2ccccc2N[C@@H]3c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C32H36N4O2S/c1-19-12-14-20(15-13-19)18-39-30-34-29(38)26-22-10-8-9-11-25(22)33-28(36(26)35-30)21-16-23(31(2,3)4)27(37)24(17-21)32(5,6)7/h8-17,28H,18H2,1-7H3,(H2,34,35,37,38)/p+1/t28-/m0/s1 |
| InChIKey | YRXSSFJQEJFUPK-NDEPHWFRSA-O |
| XLogP | 6.60 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|