C24H21N4O2S+ — CID 135874328
(6S)-3-benzylsulfanyl-6-(4-methoxyphenyl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 135874328) has the molecular formula C24H21N4O2S+ and a molecular weight of 429.53 g/mol. Its IUPAC name is (6S)-3-benzylsulfanyl-6-(4-methoxyphenyl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-3-benzylsulfanyl-6-(4-methoxyphenyl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 135874328 |
| Molecular Formula | C24H21N4O2S+ |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (6S)-3-benzylsulfanyl-6-(4-methoxyphenyl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | COc1ccc([C@H]2Nc3ccccc3-c3c(=O)[nH]c(SCc4ccccc4)n[n+]32)cc1 |
| InChI | InChI=1S/C24H20N4O2S/c1-30-18-13-11-17(12-14-18)22-25-20-10-6-5-9-19(20)21-23(29)26-24(27-28(21)22)31-15-16-7-3-2-4-8-16/h2-14,22H,15H2,1H3,(H,26,27,29)/p+1/t22-/m0/s1 |
| InChIKey | NLMCXSHTDFCHFB-QFIPXVFZSA-O |
| XLogP | 4.00 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|