C25H20BrN4O4S+ — CID 137188441
2-[2-[(6S)-3-benzylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]-4-bromophenoxy]acetic acid (PubChem CID 137188441) has the molecular formula C25H20BrN4O4S+ and a molecular weight of 552.43 g/mol. Its IUPAC name is 2-[2-[(6S)-3-benzylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]-4-bromophenoxy]acetic acid.
| Compound Name | 2-[2-[(6S)-3-benzylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]-4-bromophenoxy]acetic acid |
|---|---|
| PubChem CID | 137188441 |
| Molecular Formula | C25H20BrN4O4S+ |
| Molecular Weight | 552.43 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | 2-[2-[(6S)-3-benzylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]-4-bromophenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Br)cc1[C@H]1Nc2ccccc2-c2c(=O)[nH]c(SCc3ccccc3)n[n+]21 |
| InChI | InChI=1S/C25H19BrN4O4S/c26-16-10-11-20(34-13-21(31)32)18(12-16)23-27-19-9-5-4-8-17(19)22-24(33)28-25(29-30(22)23)35-14-15-6-2-1-3-7-15/h1-12,23H,13-14H2,(H2,28,29,31,32,33)/p+1/t23-/m0/s1 |
| InChIKey | UHTFGXJZTNNTDY-QHCPKHFHSA-O |
| XLogP | 4.22 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|