C19H17N4O4S+ — CID 137187693
2-[2-[(6S)-3-methylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid (PubChem CID 137187693) has the molecular formula C19H17N4O4S+ and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-[2-[(6S)-3-methylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(6S)-3-methylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137187693 |
| Molecular Formula | C19H17N4O4S+ |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-[2-[(6S)-3-methylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid |
| SMILES | CSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N[C@@H]2c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C19H16N4O4S/c1-28-19-21-18(26)16-11-6-2-4-8-13(11)20-17(23(16)22-19)12-7-3-5-9-14(12)27-10-15(24)25/h2-9,17H,10H2,1H3,(H2,21,22,24,25,26)/p+1/t17-/m0/s1 |
| InChIKey | AXHWWGBNYQLZOY-KRWDZBQOSA-O |
| XLogP | 1.88 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|