C24H27N4O4S+ — CID 137188119
2-[4-[(6S)-3-hexylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid (PubChem CID 137188119) has the molecular formula C24H27N4O4S+ and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[4-[(6S)-3-hexylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(6S)-3-hexylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137188119 |
| Molecular Formula | C24H27N4O4S+ |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-[4-[(6S)-3-hexylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid |
| SMILES | CCCCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N[C@@H]2c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-2-3-4-7-14-33-24-26-23(31)21-18-8-5-6-9-19(18)25-22(28(21)27-24)16-10-12-17(13-11-16)32-15-20(29)30/h5-6,8-13,22H,2-4,7,14-15H2,1H3,(H2,26,27,29,30,31)/p+1/t22-/m0/s1 |
| InChIKey | NPVNOPZQCSBVJR-QFIPXVFZSA-O |
| XLogP | 3.83 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|