C22H24N5O5S+ — CID 137188483
(6R)-6-(4-hydroxy-3-methoxy-2-nitrophenyl)-3-pentylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188483) has the molecular formula C22H24N5O5S+ and a molecular weight of 470.53 g/mol. Its IUPAC name is (6R)-6-(4-hydroxy-3-methoxy-2-nitrophenyl)-3-pentylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-6-(4-hydroxy-3-methoxy-2-nitrophenyl)-3-pentylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188483 |
| Molecular Formula | C22H24N5O5S+ |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (6R)-6-(4-hydroxy-3-methoxy-2-nitrophenyl)-3-pentylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N[C@H]2c1ccc(O)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23N5O5S/c1-3-4-7-12-33-22-24-21(29)18-13-8-5-6-9-15(13)23-20(26(18)25-22)14-10-11-16(28)19(32-2)17(14)27(30)31/h5-6,8-11,20H,3-4,7,12H2,1-2H3,(H2,24,25,28,29)/p+1/t20-/m1/s1 |
| InChIKey | VVQQBQXNGVNDGX-HXUWFJFHSA-O |
| XLogP | 3.60 |
| TPSA | 134.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|