C20H20BrN4O2S+ — CID 137188387
(6S)-6-(2-bromo-5-hydroxyphenyl)-3-butylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188387) has the molecular formula C20H20BrN4O2S+ and a molecular weight of 460.38 g/mol. Its IUPAC name is (6S)-6-(2-bromo-5-hydroxyphenyl)-3-butylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-6-(2-bromo-5-hydroxyphenyl)-3-butylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188387 |
| Molecular Formula | C20H20BrN4O2S+ |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | (6S)-6-(2-bromo-5-hydroxyphenyl)-3-butylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N[C@@H]2c1cc(O)ccc1Br |
| InChI | InChI=1S/C20H19BrN4O2S/c1-2-3-10-28-20-23-19(27)17-13-6-4-5-7-16(13)22-18(25(17)24-20)14-11-12(26)8-9-15(14)21/h4-9,11,18H,2-3,10H2,1H3,(H2,23,24,26,27)/p+1/t18-/m0/s1 |
| InChIKey | HKBZZHQXBQRWGS-SFHVURJKSA-O |
| XLogP | 4.06 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|