C24H26BrN4O4S+ — CID 137188462
2-[4-bromo-2-[(6R)-3-hexylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid (PubChem CID 137188462) has the molecular formula C24H26BrN4O4S+ and a molecular weight of 546.47 g/mol. Its IUPAC name is 2-[4-bromo-2-[(6R)-3-hexylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-bromo-2-[(6R)-3-hexylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137188462 |
| Molecular Formula | C24H26BrN4O4S+ |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 2-[4-bromo-2-[(6R)-3-hexylsulfanyl-1-oxo-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenoxy]acetic acid |
| SMILES | CCCCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N[C@H]2c1cc(Br)ccc1OCC(=O)O |
| InChI | InChI=1S/C24H25BrN4O4S/c1-2-3-4-7-12-34-24-27-23(32)21-16-8-5-6-9-18(16)26-22(29(21)28-24)17-13-15(25)10-11-19(17)33-14-20(30)31/h5-6,8-11,13,22H,2-4,7,12,14H2,1H3,(H2,27,28,30,31,32)/p+1/t22-/m1/s1 |
| InChIKey | VIACKQFYUDRLBL-JOCHJYFZSA-O |
| XLogP | 4.60 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|