C18H16IN4O3S+ — CID 137188366
(6S)-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188366) has the molecular formula C18H16IN4O3S+ and a molecular weight of 495.32 g/mol. Its IUPAC name is (6S)-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188366 |
| Molecular Formula | C18H16IN4O3S+ |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | (6S)-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | COc1cc([C@H]2Nc3ccccc3-c3c(=O)[nH]c(SC)n[n+]32)cc(I)c1O |
| InChI | InChI=1S/C18H15IN4O3S/c1-26-13-8-9(7-11(19)15(13)24)16-20-12-6-4-3-5-10(12)14-17(25)21-18(27-2)22-23(14)16/h3-8,16H,1-2H3,(H2,21,22,24,25)/p+1/t16-/m0/s1 |
| InChIKey | SNKCIFMAAUPKSY-INIZCTEOSA-O |
| XLogP | 2.74 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|