C26H21N6OS+ — CID 137187776
(6R)-3-benzylsulfanyl-6-(5-phenyl-1H-pyrazol-4-yl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137187776) has the molecular formula C26H21N6OS+ and a molecular weight of 465.56 g/mol. Its IUPAC name is (6R)-3-benzylsulfanyl-6-(5-phenyl-1H-pyrazol-4-yl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-3-benzylsulfanyl-6-(5-phenyl-1H-pyrazol-4-yl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137187776 |
| Molecular Formula | C26H21N6OS+ |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (6R)-3-benzylsulfanyl-6-(5-phenyl-1H-pyrazol-4-yl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | O=c1[nH]c(SCc2ccccc2)n[n+]2c1-c1ccccc1N[C@H]2c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C26H20N6OS/c33-25-23-19-13-7-8-14-21(19)28-24(20-15-27-30-22(20)18-11-5-2-6-12-18)32(23)31-26(29-25)34-16-17-9-3-1-4-10-17/h1-15,24H,16H2,(H2,27,29,30,31,33)/p+1/t24-/m1/s1 |
| InChIKey | BKYQITGKYRAFKH-XMMPIXPASA-O |
| XLogP | 4.38 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|