C21H19N6OS+ — CID 137188243
(6R)-3-ethylsulfanyl-6-(5-phenyl-1H-pyrazol-4-yl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188243) has the molecular formula C21H19N6OS+ and a molecular weight of 403.49 g/mol. Its IUPAC name is (6R)-3-ethylsulfanyl-6-(5-phenyl-1H-pyrazol-4-yl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-3-ethylsulfanyl-6-(5-phenyl-1H-pyrazol-4-yl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188243 |
| Molecular Formula | C21H19N6OS+ |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (6R)-3-ethylsulfanyl-6-(5-phenyl-1H-pyrazol-4-yl)-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N[C@H]2c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C21H18N6OS/c1-2-29-21-24-20(28)18-14-10-6-7-11-16(14)23-19(27(18)26-21)15-12-22-25-17(15)13-8-4-3-5-9-13/h3-12,19H,2H2,1H3,(H2,22,24,25,26,28)/p+1/t19-/m1/s1 |
| InChIKey | QABHUOFFCIMDBH-LJQANCHMSA-O |
| XLogP | 3.20 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|