C26H24ClN4O3S+ — CID 137188185
(6S)-7-acetyl-3-butylsulfanyl-6-[5-(3-chlorophenyl)furan-2-yl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188185) has the molecular formula C26H24ClN4O3S+ and a molecular weight of 508.02 g/mol. Its IUPAC name is (6S)-7-acetyl-3-butylsulfanyl-6-[5-(3-chlorophenyl)furan-2-yl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-7-acetyl-3-butylsulfanyl-6-[5-(3-chlorophenyl)furan-2-yl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188185 |
| Molecular Formula | C26H24ClN4O3S+ |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | (6S)-7-acetyl-3-butylsulfanyl-6-[5-(3-chlorophenyl)furan-2-yl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)[C@@H]2c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C26H23ClN4O3S/c1-3-4-14-35-26-28-24(33)23-19-10-5-6-11-20(19)30(16(2)32)25(31(23)29-26)22-13-12-21(34-22)17-8-7-9-18(27)15-17/h5-13,15,25H,3-4,14H2,1-2H3/p+1/t25-/m0/s1 |
| InChIKey | FVWMMRRREQBFBW-VWLOTQADSA-O |
| XLogP | 5.44 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|