C12H18ClN5O4 — CID 137193180
2-amino-7-(2-chloroethyl)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one (PubChem CID 137193180) has the molecular formula C12H18ClN5O4 and a molecular weight of 331.76 g/mol. Its IUPAC name is 2-amino-7-(2-chloroethyl)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one.
| Compound Name | 2-amino-7-(2-chloroethyl)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
|---|---|
| PubChem CID | 137193180 |
| Molecular Formula | C12H18ClN5O4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-amino-7-(2-chloroethyl)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)N(CCCl)CN2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C12H18ClN5O4/c13-1-2-17-5-18(8-3-6(20)7(4-19)22-8)10-9(17)11(21)16-12(14)15-10/h6-8,19-20H,1-5H2,(H3,14,15,16,21)/t6-,7+,8+/m0/s1 |
| InChIKey | CAXIEPMLXBZDND-XLPZGREQSA-N |
| XLogP | -1.36 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|