C17H20ClN5O5 — CID 176659739
2-amino-7-[(4-chlorophenyl)methyl]-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one (PubChem CID 176659739) has the molecular formula C17H20ClN5O5 and a molecular weight of 409.83 g/mol. Its IUPAC name is 2-amino-7-[(4-chlorophenyl)methyl]-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one.
| Compound Name | 2-amino-7-[(4-chlorophenyl)methyl]-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
|---|---|
| PubChem CID | 176659739 |
| Molecular Formula | C17H20ClN5O5 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-amino-7-[(4-chlorophenyl)methyl]-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)N(Cc1ccc(Cl)cc1)CN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H20ClN5O5/c18-9-3-1-8(2-4-9)5-22-7-23(14-11(22)15(27)21-17(19)20-14)16-13(26)12(25)10(6-24)28-16/h1-4,10,12-13,16,24-26H,5-7H2,(H3,19,20,21,27)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | YKAAIUUUYVEPFJ-XNIJJKJLSA-N |
| XLogP | -0.77 |
| TPSA | 148.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |