C17H23N5O11P2 — CID 176659735
[(2R,3S,4R,5R)-5-(2-amino-7-benzyl-6-oxo-1,8-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 176659735) has the molecular formula C17H23N5O11P2 and a molecular weight of 535.34 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-7-benzyl-6-oxo-1,8-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-7-benzyl-6-oxo-1,8-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 176659735 |
| Molecular Formula | C17H23N5O11P2 |
| Molecular Weight | 535.34 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-7-benzyl-6-oxo-1,8-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(c(=O)[nH]1)N(Cc1ccccc1)CN2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H23N5O11P2/c18-17-19-14-11(15(25)20-17)21(6-9-4-2-1-3-5-9)8-22(14)16-13(24)12(23)10(32-16)7-31-35(29,30)33-34(26,27)28/h1-5,10,12-13,16,23-24H,6-8H2,(H,29,30)(H2,26,27,28)(H3,18,19,20,25)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | DTLTVQDDNUWZGM-XNIJJKJLSA-N |
| XLogP | -1.19 |
| TPSA | 241.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.34 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|