C18H23ClN5O8P — CID 135546231
[(2R,3S,4R,5R)-5-[7-[(4-chlorophenyl)methyl]-2-(methylamino)-6-oxo-1,8-dihydropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 135546231) has the molecular formula C18H23ClN5O8P and a molecular weight of 503.84 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[7-[(4-chlorophenyl)methyl]-2-(methylamino)-6-oxo-1,8-dihydropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[7-[(4-chlorophenyl)methyl]-2-(methylamino)-6-oxo-1,8-dihydropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135546231 |
| Molecular Formula | C18H23ClN5O8P |
| Molecular Weight | 503.84 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[7-[(4-chlorophenyl)methyl]-2-(methylamino)-6-oxo-1,8-dihydropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CNc1nc2c(c(=O)[nH]1)N(Cc1ccc(Cl)cc1)CN2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H23ClN5O8P/c1-20-18-21-15-12(16(27)22-18)23(6-9-2-4-10(19)5-3-9)8-24(15)17-14(26)13(25)11(32-17)7-31-33(28,29)30/h2-5,11,13-14,17,25-26H,6-8H2,1H3,(H2,28,29,30)(H2,20,21,22,27)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | DZFWBYCUSMHXNO-LSCFUAHRSA-N |
| XLogP | -0.19 |
| TPSA | 180.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.84 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|