C9H6ClNO2 — CID 137195866
2-chloro-4-(1,3-oxazol-2-yl)phenol (PubChem CID 137195866) has the molecular formula C9H6ClNO2 and a molecular weight of 195.61 g/mol. Its IUPAC name is 2-chloro-4-(1,3-oxazol-2-yl)phenol.
| Compound Name | 2-chloro-4-(1,3-oxazol-2-yl)phenol |
|---|---|
| PubChem CID | 137195866 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 2-chloro-4-(1,3-oxazol-2-yl)phenol |
| SMILES | Oc1ccc(-c2ncco2)cc1Cl |
| InChI | InChI=1S/C9H6ClNO2/c10-7-5-6(1-2-8(7)12)9-11-3-4-13-9/h1-5,12H |
| InChIKey | KGUMEMCKASJYKT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |