C7H16N6 — CID 137197668
4-N',6-N-dimethyl-2-methylimino-1,3-dihydropyrimidine-4,4,6-triamine (PubChem CID 137197668) has the molecular formula C7H16N6 and a molecular weight of 184.25 g/mol. Its IUPAC name is 4-N',6-N-dimethyl-2-methylimino-1,3-dihydropyrimidine-4,4,6-triamine.
| Compound Name | 4-N',6-N-dimethyl-2-methylimino-1,3-dihydropyrimidine-4,4,6-triamine |
|---|---|
| PubChem CID | 137197668 |
| Molecular Formula | C7H16N6 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 4-N',6-N-dimethyl-2-methylimino-1,3-dihydropyrimidine-4,4,6-triamine |
| SMILES | C/N=C1\NC(NC)=CC(N)(NC)N1 |
| InChI | InChI=1S/C7H16N6/c1-9-5-4-7(8,11-3)13-6(10-2)12-5/h4,9,11H,8H2,1-3H3,(H2,10,12,13) |
| InChIKey | TZIZSCNMBJAGFO-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|