C13H29N5 — CID 54188510
2-[4,4-bis(ethylamino)but-3-enyl]-1,3-diethylguanidine (PubChem CID 54188510) has the molecular formula C13H29N5 and a molecular weight of 255.41 g/mol. Its IUPAC name is 2-[4,4-bis(ethylamino)but-3-enyl]-1,3-diethylguanidine.
| Compound Name | 2-[4,4-bis(ethylamino)but-3-enyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 54188510 |
| Molecular Formula | C13H29N5 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.24 |
| IUPAC Name | 2-[4,4-bis(ethylamino)but-3-enyl]-1,3-diethylguanidine |
| SMILES | CCNC(=CCCN=C(NCC)NCC)NCC |
| InChI | InChI=1S/C13H29N5/c1-5-14-12(15-6-2)10-9-11-18-13(16-7-3)17-8-4/h10,14-15H,5-9,11H2,1-4H3,(H2,16,17,18) |
| InChIKey | BSLYCUDZMLKFEY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|