C13H29N5 — CID 59915286
1,3-diethyl-2-[2-[[(E)-1-(ethylamino)but-1-enyl]amino]ethyl]guanidine (PubChem CID 59915286) has the molecular formula C13H29N5 and a molecular weight of 255.41 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-[[(E)-1-(ethylamino)but-1-enyl]amino]ethyl]guanidine.
| Compound Name | 1,3-diethyl-2-[2-[[(E)-1-(ethylamino)but-1-enyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 59915286 |
| Molecular Formula | C13H29N5 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.24 |
| IUPAC Name | 1,3-diethyl-2-[2-[[(E)-1-(ethylamino)but-1-enyl]amino]ethyl]guanidine |
| SMILES | CC/C=C(\NCC)NCCN=C(NCC)NCC |
| InChI | InChI=1S/C13H29N5/c1-5-9-12(14-6-2)17-10-11-18-13(15-7-3)16-8-4/h9,14,17H,5-8,10-11H2,1-4H3,(H2,15,16,18)/b12-9+ |
| InChIKey | YIAXNKHPFHLIRU-FMIVXFBMSA-N |
| XLogP | 1.01 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|