C17H19ClF3N3O2 — CID 137203741
ethyl 5-[(2E,4E)-5-chlorohepta-2,4,6-trien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 137203741) has the molecular formula C17H19ClF3N3O2 and a molecular weight of 389.81 g/mol. Its IUPAC name is ethyl 5-[(2E,4E)-5-chlorohepta-2,4,6-trien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-[(2E,4E)-5-chlorohepta-2,4,6-trien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 137203741 |
| Molecular Formula | C17H19ClF3N3O2 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | ethyl 5-[(2E,4E)-5-chlorohepta-2,4,6-trien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | C=C/C(Cl)=C\C(=C/C)C1CC(C(F)(F)F)n2ncc(C(=O)OCC)c2N1 |
| InChI | InChI=1S/C17H19ClF3N3O2/c1-4-10(7-11(18)5-2)13-8-14(17(19,20)21)24-15(23-13)12(9-22-24)16(25)26-6-3/h4-5,7,9,13-14,23H,2,6,8H2,1,3H3/b10-4+,11-7+ |
| InChIKey | MWJSUTPWKWEPHG-ATTFBSEUSA-N |
| XLogP | 4.60 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|