C20H28ClN5O3 — CID 137203969
tert-butyl 4-[6-[[(E)-4-chloro-4-imino-1-(methylamino)-1-oxobut-2-en-2-yl]amino]-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 137203969) has the molecular formula C20H28ClN5O3 and a molecular weight of 421.93 g/mol. Its IUPAC name is tert-butyl 4-[6-[[(E)-4-chloro-4-imino-1-(methylamino)-1-oxobut-2-en-2-yl]amino]-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[[(E)-4-chloro-4-imino-1-(methylamino)-1-oxobut-2-en-2-yl]amino]-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137203969 |
| Molecular Formula | C20H28ClN5O3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl 4-[6-[[(E)-4-chloro-4-imino-1-(methylamino)-1-oxobut-2-en-2-yl]amino]-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | [H]/N=C(Cl)/C=C(/Nc1ccc(C2CCN(C(=O)OC(C)(C)C)CC2)cn1)C(=O)NC |
| InChI | InChI=1S/C20H28ClN5O3/c1-20(2,3)29-19(28)26-9-7-13(8-10-26)14-5-6-17(24-12-14)25-15(11-16(21)22)18(27)23-4/h5-6,11-13,22H,7-10H2,1-4H3,(H,23,27)(H,24,25)/b15-11+,22-16- |
| InChIKey | UZPWOAHHERRQRZ-BGFDYXISSA-N |
| XLogP | 3.45 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|