C14H17N3 — CID 137205934
N'-cyclopropyl-4,6-dimethyl-1H-indole-3-carboximidamide (PubChem CID 137205934) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is N'-cyclopropyl-4,6-dimethyl-1H-indole-3-carboximidamide.
| Compound Name | N'-cyclopropyl-4,6-dimethyl-1H-indole-3-carboximidamide |
|---|---|
| PubChem CID | 137205934 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | N'-cyclopropyl-4,6-dimethyl-1H-indole-3-carboximidamide |
| SMILES | Cc1cc(C)c2c(/C(N)=N/C3CC3)c[nH]c2c1 |
| InChI | InChI=1S/C14H17N3/c1-8-5-9(2)13-11(7-16-12(13)6-8)14(15)17-10-3-4-10/h5-7,10,16H,3-4H2,1-2H3,(H2,15,17) |
| InChIKey | BBHXTRGEQDPBTR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|