C17H20N2O4S — CID 137211348
2-(4-methylphenyl)imino-8-(propan-2-yloxymethyl)-7-oxa-1-thia-3-azaspiro[4.4]nonane-4,6-dione (PubChem CID 137211348) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-(4-methylphenyl)imino-8-(propan-2-yloxymethyl)-7-oxa-1-thia-3-azaspiro[4.4]nonane-4,6-dione.
| Compound Name | 2-(4-methylphenyl)imino-8-(propan-2-yloxymethyl)-7-oxa-1-thia-3-azaspiro[4.4]nonane-4,6-dione |
|---|---|
| PubChem CID | 137211348 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-(4-methylphenyl)imino-8-(propan-2-yloxymethyl)-7-oxa-1-thia-3-azaspiro[4.4]nonane-4,6-dione |
| SMILES | Cc1ccc(/N=C2\NC(=O)C3(CC(COC(C)C)OC3=O)S2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-10(2)22-9-13-8-17(15(21)23-13)14(20)19-16(24-17)18-12-6-4-11(3)5-7-12/h4-7,10,13H,8-9H2,1-3H3,(H,18,19,20) |
| InChIKey | VUNVXEPBRQKOLR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|