C22H26N4O5S — CID 137211798
2-methoxy-4-[(E)-[[1-(5-methyl-1,1-dioxo-1,2-benzothiazol-3-yl)-2-morpholin-4-ylethyl]hydrazinylidene]methyl]phenol (PubChem CID 137211798) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-methoxy-4-[(E)-[[1-(5-methyl-1,1-dioxo-1,2-benzothiazol-3-yl)-2-morpholin-4-ylethyl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-methoxy-4-[(E)-[[1-(5-methyl-1,1-dioxo-1,2-benzothiazol-3-yl)-2-morpholin-4-ylethyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137211798 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-methoxy-4-[(E)-[[1-(5-methyl-1,1-dioxo-1,2-benzothiazol-3-yl)-2-morpholin-4-ylethyl]hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N/NC(CN2CCOCC2)C2=NS(=O)(=O)c3ccc(C)cc32)ccc1O |
| InChI | InChI=1S/C22H26N4O5S/c1-15-3-6-21-17(11-15)22(25-32(21,28)29)18(14-26-7-9-31-10-8-26)24-23-13-16-4-5-19(27)20(12-16)30-2/h3-6,11-13,18,24,27H,7-10,14H2,1-2H3/b23-13+ |
| InChIKey | AFZMDAYLYZBWMM-YDZHTSKRSA-N |
| XLogP | 1.53 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|