C16H21N7O4 — CID 137304084
N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(5-morpholin-4-yltetrazol-2-yl)propanamide (PubChem CID 137304084) has the molecular formula C16H21N7O4 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(5-morpholin-4-yltetrazol-2-yl)propanamide.
| Compound Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(5-morpholin-4-yltetrazol-2-yl)propanamide |
|---|---|
| PubChem CID | 137304084 |
| Molecular Formula | C16H21N7O4 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(5-morpholin-4-yltetrazol-2-yl)propanamide |
| SMILES | COc1cc(/C=N/NC(=O)C(C)n2nnc(N3CCOCC3)n2)ccc1O |
| InChI | InChI=1S/C16H21N7O4/c1-11(23-20-16(19-21-23)22-5-7-27-8-6-22)15(25)18-17-10-12-3-4-13(24)14(9-12)26-2/h3-4,9-11,24H,5-8H2,1-2H3,(H,18,25)/b17-10+ |
| InChIKey | CZSFNSZLEBQJBO-LICLKQGHSA-N |
| XLogP | -0.06 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|