C15H18ClN7O2 — CID 134092932
N-[(E)-(2-chlorophenyl)methylideneamino]-2-(5-morpholin-4-yltetrazol-2-yl)propanamide (PubChem CID 134092932) has the molecular formula C15H18ClN7O2 and a molecular weight of 363.81 g/mol. Its IUPAC name is N-[(E)-(2-chlorophenyl)methylideneamino]-2-(5-morpholin-4-yltetrazol-2-yl)propanamide.
| Compound Name | N-[(E)-(2-chlorophenyl)methylideneamino]-2-(5-morpholin-4-yltetrazol-2-yl)propanamide |
|---|---|
| PubChem CID | 134092932 |
| Molecular Formula | C15H18ClN7O2 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[(E)-(2-chlorophenyl)methylideneamino]-2-(5-morpholin-4-yltetrazol-2-yl)propanamide |
| SMILES | CC(C(=O)N/N=C/c1ccccc1Cl)n1nnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H18ClN7O2/c1-11(14(24)18-17-10-12-4-2-3-5-13(12)16)23-20-15(19-21-23)22-6-8-25-9-7-22/h2-5,10-11H,6-9H2,1H3,(H,18,24)/b17-10+ |
| InChIKey | DPBABQZGWUQWFS-LICLKQGHSA-N |
| XLogP | 0.87 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|