C29H29N7 — CID 137211925
[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-4-[4-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-5-yl]methanimine (PubChem CID 137211925) has the molecular formula C29H29N7 and a molecular weight of 475.60 g/mol. Its IUPAC name is [2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-4-[4-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-5-yl]methanimine.
| Compound Name | [2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-4-[4-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-5-yl]methanimine |
|---|---|
| PubChem CID | 137211925 |
| Molecular Formula | C29H29N7 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | [2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-4-[4-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-5-yl]methanimine |
| SMILES | [H]/N=C/c1[nH]c([C@@H]2C[C@H]3C[C@H]3N2)nc1-c1ccc(-c2ccc(-c3cnc([C@@H]4C[C@H]5C[C@H]5N4)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C29H29N7/c30-13-25-27(36-29(34-25)24-12-20-10-22(20)33-24)18-7-3-16(4-8-18)15-1-5-17(6-2-15)26-14-31-28(35-26)23-11-19-9-21(19)32-23/h1-8,13-14,19-24,30,32-33H,9-12H2,(H,31,35)(H,34,36)/b30-13+/t19-,20-,21-,22-,23+,24+/m1/s1 |
| InChIKey | QOHYYAFMKZQHCD-HPXIFESJSA-N |
| XLogP | 4.98 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|