C30H30N6 — CID 58209601
(1R,3S,5R)-3-[5-[4-[(E)-2-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]phenyl]ethenyl]phenyl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane (PubChem CID 58209601) has the molecular formula C30H30N6 and a molecular weight of 474.61 g/mol. Its IUPAC name is (1R,3S,5R)-3-[5-[4-[(E)-2-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]phenyl]ethenyl]phenyl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,3S,5R)-3-[5-[4-[(E)-2-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]phenyl]ethenyl]phenyl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 58209601 |
| Molecular Formula | C30H30N6 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (1R,3S,5R)-3-[5-[4-[(E)-2-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]phenyl]ethenyl]phenyl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane |
| SMILES | C(=C/c1ccc(-c2cnc([C@@H]3C[C@H]4C[C@H]4N3)[nH]2)cc1)\c1ccc(-c2cnc([C@@H]3C[C@H]4C[C@H]4N3)[nH]2)cc1 |
| InChI | InChI=1S/C30H30N6/c1(17-3-7-19(8-4-17)27-15-31-29(35-27)25-13-21-11-23(21)33-25)2-18-5-9-20(10-6-18)28-16-32-30(36-28)26-14-22-12-24(22)34-26/h1-10,15-16,21-26,33-34H,11-14H2,(H,31,35)(H,32,36)/b2-1+/t21-,22-,23-,24-,25+,26+/m1/s1 |
| InChIKey | OZSRKKVWWOLBFM-YINJDPGFSA-N |
| XLogP | 5.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|