C28H26N6 — CID 66982103
(1R,3S,5R)-3-[5-[6-[2-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl]naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane (PubChem CID 66982103) has the molecular formula C28H26N6 and a molecular weight of 446.56 g/mol. Its IUPAC name is (1R,3S,5R)-3-[5-[6-[2-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl]naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,3S,5R)-3-[5-[6-[2-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl]naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 66982103 |
| Molecular Formula | C28H26N6 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (1R,3S,5R)-3-[5-[6-[2-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl]naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane |
| SMILES | C(#Cc1cnc([C@@H]2C[C@H]3C[C@H]3N2)[nH]1)c1ccc2cc(-c3cnc([C@@H]4C[C@H]5C[C@H]5N4)[nH]3)ccc2c1 |
| InChI | InChI=1S/C28H26N6/c1-3-17-8-18(26-14-30-28(34-26)25-12-20-10-23(20)33-25)5-4-16(17)7-15(1)2-6-21-13-29-27(31-21)24-11-19-9-22(19)32-24/h1,3-5,7-8,13-14,19-20,22-25,32-33H,9-12H2,(H,29,31)(H,30,34)/t19-,20-,22-,23-,24+,25+/m1/s1 |
| InChIKey | WHEKFGICIVBXFO-HITKPJKISA-N |
| XLogP | 4.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|