C15H14N2O2 — CID 137214884
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-hydroxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 137214884) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-hydroxypyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-hydroxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 137214884 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-hydroxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C/C=C\C(=C/C)c1c(O)nc2ccccn2c1=O |
| InChI | InChI=1S/C15H14N2O2/c1-3-5-8-11(4-2)13-14(18)16-12-9-6-7-10-17(12)15(13)19/h3-10,18H,1H2,2H3/b8-5-,11-4+ |
| InChIKey | LRAVRIMYSCXMMH-CDXXIHCBSA-N |
| XLogP | 2.55 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|