C13H8N4O5 — CID 137224601
5-[(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 137224601) has the molecular formula C13H8N4O5 and a molecular weight of 300.23 g/mol. Its IUPAC name is 5-[(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 137224601 |
| Molecular Formula | C13H8N4O5 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 5-[(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2c(O)nc3ccccn3c2=O)C(=O)N1 |
| InChI | InChI=1S/C13H8N4O5/c18-9-6(10(19)16-13(22)15-9)5-7-11(20)14-8-3-1-2-4-17(8)12(7)21/h1-5,20H,(H2,15,16,18,19,22) |
| InChIKey | BIBUXMGXERMAJX-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|