C12H9ClN2O3 — CID 84818363
methyl (E)-3-(2-chloro-4-oxopyrido[1,2-a]pyrimidin-3-yl)prop-2-enoate (PubChem CID 84818363) has the molecular formula C12H9ClN2O3 and a molecular weight of 264.67 g/mol. Its IUPAC name is methyl (E)-3-(2-chloro-4-oxopyrido[1,2-a]pyrimidin-3-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(2-chloro-4-oxopyrido[1,2-a]pyrimidin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 84818363 |
| Molecular Formula | C12H9ClN2O3 |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | methyl (E)-3-(2-chloro-4-oxopyrido[1,2-a]pyrimidin-3-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1c(Cl)nc2ccccn2c1=O |
| InChI | InChI=1S/C12H9ClN2O3/c1-18-10(16)6-5-8-11(13)14-9-4-2-3-7-15(9)12(8)17/h2-7H,1H3/b6-5+ |
| InChIKey | ZYFAZDPWQGBYBR-AATRIKPKSA-N |
| XLogP | 1.53 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|