C15H11N3O3 — CID 137316980
N-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)benzamide (PubChem CID 137316980) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is N-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)benzamide.
| Compound Name | N-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)benzamide |
|---|---|
| PubChem CID | 137316980 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)benzamide |
| SMILES | O=C(Nc1c(O)nc2ccccn2c1=O)c1ccccc1 |
| InChI | InChI=1S/C15H11N3O3/c19-13(10-6-2-1-3-7-10)17-12-14(20)16-11-8-4-5-9-18(11)15(12)21/h1-9,20H,(H,17,19) |
| InChIKey | OVJYJPOJHJHBBO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |