C23H28N6O — CID 137214996
(8S,14S)-3-methyl-7-oxa-10,16,19,23,24,27-hexazahexacyclo[18.5.2.12,6.18,16.010,14.023,26]nonacosa-1(26),2,4,6(29),20(27),21,24-heptaene (PubChem CID 137214996) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is (8S,14S)-3-methyl-7-oxa-10,16,19,23,24,27-hexazahexacyclo[18.5.2.12,6.18,16.010,14.023,26]nonacosa-1(26),2,4,6(29),20(27),21,24-heptaene.
| Compound Name | (8S,14S)-3-methyl-7-oxa-10,16,19,23,24,27-hexazahexacyclo[18.5.2.12,6.18,16.010,14.023,26]nonacosa-1(26),2,4,6(29),20(27),21,24-heptaene |
|---|---|
| PubChem CID | 137214996 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | (8S,14S)-3-methyl-7-oxa-10,16,19,23,24,27-hexazahexacyclo[18.5.2.12,6.18,16.010,14.023,26]nonacosa-1(26),2,4,6(29),20(27),21,24-heptaene |
| SMILES | Cc1ccc2cc1-c1cnn3ccc(nc13)NCCN1C[C@@H](CN3CCC[C@H]3C1)O2 |
| InChI | InChI=1S/C23H28N6O/c1-16-4-5-18-11-20(16)21-12-25-29-9-6-22(26-23(21)29)24-7-10-27-13-17-3-2-8-28(17)15-19(14-27)30-18/h4-6,9,11-12,17,19H,2-3,7-8,10,13-15H2,1H3,(H,24,26)/t17-,19-/m0/s1 |
| InChIKey | NJCMMUDTUWVIAH-HKUYNNGSSA-N |
| XLogP | 2.66 |
| TPSA | 57.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |