C10H11NO3 — CID 137216130
2-(5-methoxy-4,5-dihydro-1,2-oxazol-3-yl)phenol (PubChem CID 137216130) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-(5-methoxy-4,5-dihydro-1,2-oxazol-3-yl)phenol.
| Compound Name | 2-(5-methoxy-4,5-dihydro-1,2-oxazol-3-yl)phenol |
|---|---|
| PubChem CID | 137216130 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-(5-methoxy-4,5-dihydro-1,2-oxazol-3-yl)phenol |
| SMILES | COC1CC(c2ccccc2O)=NO1 |
| InChI | InChI=1S/C10H11NO3/c1-13-10-6-8(11-14-10)7-4-2-3-5-9(7)12/h2-5,10,12H,6H2,1H3 |
| InChIKey | CXPHQUXQNRFIKV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |