C15H14NO3PS — CID 136784254
2-[5-(4-methoxyphenyl)-5-sulfido-4H-1,2,5-oxazaphosphol-5-ium-3-yl]phenol (PubChem CID 136784254) has the molecular formula C15H14NO3PS and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-5-sulfido-4H-1,2,5-oxazaphosphol-5-ium-3-yl]phenol.
| Compound Name | 2-[5-(4-methoxyphenyl)-5-sulfido-4H-1,2,5-oxazaphosphol-5-ium-3-yl]phenol |
|---|---|
| PubChem CID | 136784254 |
| Molecular Formula | C15H14NO3PS |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-5-sulfido-4H-1,2,5-oxazaphosphol-5-ium-3-yl]phenol |
| SMILES | COc1ccc([P+]2([S-])CC(c3ccccc3O)=NO2)cc1 |
| InChI | InChI=1S/C15H14NO3PS/c1-18-11-6-8-12(9-7-11)20(21)10-14(16-19-20)13-4-2-3-5-15(13)17/h2-9,17H,10H2,1H3 |
| InChIKey | FYXNCRCTWVIOSG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|