C24H26N4O8 — CID 137217303
(1-hydroxy-2,5-dioxopyrrolidin-3-yl) 4-[[2-hydroxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]diazenyl]benzoate (PubChem CID 137217303) has the molecular formula C24H26N4O8 and a molecular weight of 498.49 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-3-yl) 4-[[2-hydroxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]diazenyl]benzoate.
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-3-yl) 4-[[2-hydroxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 137217303 |
| Molecular Formula | C24H26N4O8 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-3-yl) 4-[[2-hydroxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]diazenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(O)c(/N=N/c2ccc(C(=O)OC3CC(=O)N(O)C3=O)cc2)c1 |
| InChI | InChI=1S/C24H26N4O8/c1-24(2,3)36-23(33)25-11-10-14-4-9-18(29)17(12-14)27-26-16-7-5-15(6-8-16)22(32)35-19-13-20(30)28(34)21(19)31/h4-9,12,19,29,34H,10-11,13H2,1-3H3,(H,25,33)/b27-26+ |
| InChIKey | GXIIBYWFKJIROG-CYYJNZCTSA-N |
| XLogP | 3.55 |
| TPSA | 167.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|