C34H53N5O9 — CID 139444760
tert-butyl N-[2-[3-[[4-[3-[2-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]propylcarbamoyl]phenyl]diazenyl]-4-hydroxyphenyl]ethyl]carbamate (PubChem CID 139444760) has the molecular formula C34H53N5O9 and a molecular weight of 675.82 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[4-[3-[2-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]propylcarbamoyl]phenyl]diazenyl]-4-hydroxyphenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[4-[3-[2-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]propylcarbamoyl]phenyl]diazenyl]-4-hydroxyphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 139444760 |
| Molecular Formula | C34H53N5O9 |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.38 |
| IUPAC Name | tert-butyl N-[2-[3-[[4-[3-[2-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]propylcarbamoyl]phenyl]diazenyl]-4-hydroxyphenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(O)c(/N=N/c2ccc(C(=O)NCCCOCCOCCOCCOCCOCCCN)cc2)c1 |
| InChI | InChI=1S/C34H53N5O9/c1-34(2,3)48-33(42)37-15-12-27-6-11-31(40)30(26-27)39-38-29-9-7-28(8-10-29)32(41)36-14-5-17-44-19-21-46-23-25-47-24-22-45-20-18-43-16-4-13-35/h6-11,26,40H,4-5,12-25,35H2,1-3H3,(H,36,41)(H,37,42)/b39-38+ |
| InChIKey | VGNAZMYCJNSYOD-YMZYAJTMSA-N |
| XLogP | 4.43 |
| TPSA | 184.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|