C24H27N3O5 — CID 146433512
4-[[5-[2-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]ethyl]-2-hydroxyphenyl]diazenyl]benzoic acid (PubChem CID 146433512) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-[[5-[2-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]ethyl]-2-hydroxyphenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[5-[2-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]ethyl]-2-hydroxyphenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 146433512 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-[[5-[2-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]ethyl]-2-hydroxyphenyl]diazenyl]benzoic acid |
| SMILES | O=C(NCCc1ccc(O)c(/N=N/c2ccc(C(=O)O)cc2)c1)OC1CC/C=C\CCC1 |
| InChI | InChI=1S/C24H27N3O5/c28-22-13-8-17(14-15-25-24(31)32-20-6-4-2-1-3-5-7-20)16-21(22)27-26-19-11-9-18(10-12-19)23(29)30/h1-2,8-13,16,20,28H,3-7,14-15H2,(H,25,31)(H,29,30)/b2-1-,27-26+ |
| InChIKey | XEWYTZSKGXJESM-PPSOUNNCSA-N |
| XLogP | 5.66 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|