C22H15N5OS2 — CID 137222937
2-(2-benzylidenehydrazinyl)-5,7-dithiophen-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 137222937) has the molecular formula C22H15N5OS2 and a molecular weight of 429.53 g/mol. Its IUPAC name is 2-(2-benzylidenehydrazinyl)-5,7-dithiophen-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-benzylidenehydrazinyl)-5,7-dithiophen-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137222937 |
| Molecular Formula | C22H15N5OS2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-(2-benzylidenehydrazinyl)-5,7-dithiophen-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(NN=Cc2ccccc2)nc2nc(-c3cccs3)cc(-c3cccs3)c12 |
| InChI | InChI=1S/C22H15N5OS2/c28-21-19-15(17-8-4-10-29-17)12-16(18-9-5-11-30-18)24-20(19)25-22(26-21)27-23-13-14-6-2-1-3-7-14/h1-13H,(H2,24,25,26,27,28) |
| InChIKey | DBTRUKLDYHUJJJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|