C7H5NO3 — CID 137225234
1,2-benzoxazole-4,7-diol (PubChem CID 137225234) has the molecular formula C7H5NO3 and a molecular weight of 151.12 g/mol. Its IUPAC name is 1,2-benzoxazole-4,7-diol.
| Compound Name | 1,2-benzoxazole-4,7-diol |
|---|---|
| PubChem CID | 137225234 |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 1,2-benzoxazole-4,7-diol |
| SMILES | Oc1ccc(O)c2oncc12 |
| InChI | InChI=1S/C7H5NO3/c9-5-1-2-6(10)7-4(5)3-8-11-7/h1-3,9-10H |
| InChIKey | YSBLGDWOGFZYBD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|