C24H22ClN5O2 — CID 137228732
9-(4-chlorophenyl)-6,6-dimethyl-3-phenyldiazenyl-4,5,7,9-tetrahydro-1H-pyrazolo[5,1-b]quinazoline-2,8-dione (PubChem CID 137228732) has the molecular formula C24H22ClN5O2 and a molecular weight of 447.93 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-6,6-dimethyl-3-phenyldiazenyl-4,5,7,9-tetrahydro-1H-pyrazolo[5,1-b]quinazoline-2,8-dione.
| Compound Name | 9-(4-chlorophenyl)-6,6-dimethyl-3-phenyldiazenyl-4,5,7,9-tetrahydro-1H-pyrazolo[5,1-b]quinazoline-2,8-dione |
|---|---|
| PubChem CID | 137228732 |
| Molecular Formula | C24H22ClN5O2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 9-(4-chlorophenyl)-6,6-dimethyl-3-phenyldiazenyl-4,5,7,9-tetrahydro-1H-pyrazolo[5,1-b]quinazoline-2,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1c(/N=N/c3ccccc3)c(=O)[nH]n1C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClN5O2/c1-24(2)12-17-19(18(31)13-24)21(14-8-10-15(25)11-9-14)30-22(26-17)20(23(32)29-30)28-27-16-6-4-3-5-7-16/h3-11,21,26H,12-13H2,1-2H3,(H,29,32)/b28-27+ |
| InChIKey | ZGLOOUSZAHJYMZ-BYYHNAKLSA-N |
| XLogP | 5.90 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|