C27H23ClN6O3S — CID 137228778
ethyl 4-amino-12-[(4-chlorophenyl)diazenyl]-13-oxo-16-phenyl-5-thia-10,14,15-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,11-tetraene-3-carboxylate (PubChem CID 137228778) has the molecular formula C27H23ClN6O3S and a molecular weight of 547.04 g/mol. Its IUPAC name is ethyl 4-amino-12-[(4-chlorophenyl)diazenyl]-13-oxo-16-phenyl-5-thia-10,14,15-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,11-tetraene-3-carboxylate.
| Compound Name | ethyl 4-amino-12-[(4-chlorophenyl)diazenyl]-13-oxo-16-phenyl-5-thia-10,14,15-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,11-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 137228778 |
| Molecular Formula | C27H23ClN6O3S |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | ethyl 4-amino-12-[(4-chlorophenyl)diazenyl]-13-oxo-16-phenyl-5-thia-10,14,15-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,11-tetraene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1C1=C(CC2)Nc2c(/N=N/c3ccc(Cl)cc3)c(=O)[nH]n2C1c1ccccc1 |
| InChI | InChI=1S/C27H23ClN6O3S/c1-2-37-27(36)21-20-18(38-24(21)29)13-12-17-19(20)23(14-6-4-3-5-7-14)34-25(30-17)22(26(35)33-34)32-31-16-10-8-15(28)9-11-16/h3-11,23,30H,2,12-13,29H2,1H3,(H,33,35)/b32-31+ |
| InChIKey | HYMDNUHZLBIVDA-QNEJGDQOSA-N |
| XLogP | 6.44 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|